C24H28N4O2 — CID 108532064
2-[4-(2,3-dimethylphenyl)piperazin-1-yl]-N-[2-(1H-indol-3-yl)ethyl]-2-oxoacetamide (PubChem CID 108532064) has the molecular formula C24H28N4O2 and a molecular weight of 404.51 g/mol. Its IUPAC name is 2-[4-(2,3-dimethylphenyl)piperazin-1-yl]-N-[2-(1H-indol-3-yl)ethyl]-2-oxoacetamide.
| Compound Name | 2-[4-(2,3-dimethylphenyl)piperazin-1-yl]-N-[2-(1H-indol-3-yl)ethyl]-2-oxoacetamide |
|---|---|
| PubChem CID | 108532064 |
| Molecular Formula | C24H28N4O2 |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.22 |
| IUPAC Name | 2-[4-(2,3-dimethylphenyl)piperazin-1-yl]-N-[2-(1H-indol-3-yl)ethyl]-2-oxoacetamide |
| SMILES | Cc1cccc(N2CCN(C(=O)C(=O)NCCc3c[nH]c4ccccc34)CC2)c1C |
| InChI | InChI=1S/C24H28N4O2/c1-17-6-5-9-22(18(17)2)27-12-14-28(15-13-27)24(30)23(29)25-11-10-19-16-26-21-8-4-3-7-20(19)21/h3-9,16,26H,10-15H2,1-2H3,(H,25,29) |
| InChIKey | YLTGTBLTCXXVEW-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 68.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|