C21H21N3O2 — CID 108505742
2-(3,4-dihydro-2H-quinolin-1-yl)-N-[2-(1H-indol-3-yl)ethyl]-2-oxoacetamide (PubChem CID 108505742) has the molecular formula C21H21N3O2 and a molecular weight of 347.42 g/mol. Its IUPAC name is 2-(3,4-dihydro-2H-quinolin-1-yl)-N-[2-(1H-indol-3-yl)ethyl]-2-oxoacetamide.
| Compound Name | 2-(3,4-dihydro-2H-quinolin-1-yl)-N-[2-(1H-indol-3-yl)ethyl]-2-oxoacetamide |
|---|---|
| PubChem CID | 108505742 |
| Molecular Formula | C21H21N3O2 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.16 |
| IUPAC Name | 2-(3,4-dihydro-2H-quinolin-1-yl)-N-[2-(1H-indol-3-yl)ethyl]-2-oxoacetamide |
| SMILES | O=C(NCCc1c[nH]c2ccccc12)C(=O)N1CCCc2ccccc21 |
| InChI | InChI=1S/C21H21N3O2/c25-20(21(26)24-13-5-7-15-6-1-4-10-19(15)24)22-12-11-16-14-23-18-9-3-2-8-17(16)18/h1-4,6,8-10,14,23H,5,7,11-13H2,(H,22,25) |
| InChIKey | VLGFQHHFEIFKCN-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 65.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|