C23H24N2O3 — CID 7659250
[2-(3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl] 4-(1H-indol-3-yl)butanoate (PubChem CID 7659250) has the molecular formula C23H24N2O3 and a molecular weight of 376.46 g/mol. Its IUPAC name is [2-(3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl] 4-(1H-indol-3-yl)butanoate.
| Compound Name | [2-(3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl] 4-(1H-indol-3-yl)butanoate |
|---|---|
| PubChem CID | 7659250 |
| Molecular Formula | C23H24N2O3 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | [2-(3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl] 4-(1H-indol-3-yl)butanoate |
| SMILES | O=C(CCCc1c[nH]c2ccccc12)OCC(=O)N1CCCc2ccccc21 |
| InChI | InChI=1S/C23H24N2O3/c26-22(25-14-6-9-17-7-1-4-12-21(17)25)16-28-23(27)13-5-8-18-15-24-20-11-3-2-10-19(18)20/h1-4,7,10-12,15,24H,5-6,8-9,13-14,16H2 |
| InChIKey | CCUQIYQQGXOXQA-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 62.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |