C24H21NO4 — CID 174814617
(2-naphthalen-1-yloxy-2-oxoethyl) 4-(1H-indol-3-yl)butanoate (PubChem CID 174814617) has the molecular formula C24H21NO4 and a molecular weight of 387.44 g/mol. Its IUPAC name is (2-naphthalen-1-yloxy-2-oxoethyl) 4-(1H-indol-3-yl)butanoate.
| Compound Name | (2-naphthalen-1-yloxy-2-oxoethyl) 4-(1H-indol-3-yl)butanoate |
|---|---|
| PubChem CID | 174814617 |
| Molecular Formula | C24H21NO4 |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.15 |
| IUPAC Name | (2-naphthalen-1-yloxy-2-oxoethyl) 4-(1H-indol-3-yl)butanoate |
| SMILES | O=C(CCCc1c[nH]c2ccccc12)OCC(=O)Oc1cccc2ccccc12 |
| InChI | InChI=1S/C24H21NO4/c26-23(14-6-9-18-15-25-21-12-4-3-10-19(18)21)28-16-24(27)29-22-13-5-8-17-7-1-2-11-20(17)22/h1-5,7-8,10-13,15,25H,6,9,14,16H2 |
| InChIKey | NMHAKAWQXPFBSP-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 68.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|