C22H22N2O3 — CID 2423316
[2-(2,3-dihydroindol-1-yl)-2-oxoethyl] 4-(1H-indol-3-yl)butanoate (PubChem CID 2423316) has the molecular formula C22H22N2O3 and a molecular weight of 362.43 g/mol. Its IUPAC name is [2-(2,3-dihydroindol-1-yl)-2-oxoethyl] 4-(1H-indol-3-yl)butanoate.
| Compound Name | [2-(2,3-dihydroindol-1-yl)-2-oxoethyl] 4-(1H-indol-3-yl)butanoate |
|---|---|
| PubChem CID | 2423316 |
| Molecular Formula | C22H22N2O3 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.16 |
| IUPAC Name | [2-(2,3-dihydroindol-1-yl)-2-oxoethyl] 4-(1H-indol-3-yl)butanoate |
| SMILES | O=C(CCCc1c[nH]c2ccccc12)OCC(=O)N1CCc2ccccc21 |
| InChI | InChI=1S/C22H22N2O3/c25-21(24-13-12-16-6-1-4-10-20(16)24)15-27-22(26)11-5-7-17-14-23-19-9-3-2-8-18(17)19/h1-4,6,8-10,14,23H,5,7,11-13,15H2 |
| InChIKey | RXCQZKWPWNSPGH-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 62.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |