C23H26FN5O — CID 111972228
1-[2-(3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]-3-[2-(5-fluoro-1H-indol-3-yl)ethyl]-2-methylguanidine (PubChem CID 111972228) has the molecular formula C23H26FN5O and a molecular weight of 407.49 g/mol. Its IUPAC name is 1-[2-(3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]-3-[2-(5-fluoro-1H-indol-3-yl)ethyl]-2-methylguanidine.
| Compound Name | 1-[2-(3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]-3-[2-(5-fluoro-1H-indol-3-yl)ethyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111972228 |
| Molecular Formula | C23H26FN5O |
| Molecular Weight | 407.49 g/mol |
| Exact Mass | 407.21 |
| IUPAC Name | 1-[2-(3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]-3-[2-(5-fluoro-1H-indol-3-yl)ethyl]-2-methylguanidine |
| SMILES | C/N=C(\NCCc1c[nH]c2ccc(F)cc12)NCC(=O)N1CCCc2ccccc21 |
| InChI | InChI=1S/C23H26FN5O/c1-25-23(26-11-10-17-14-27-20-9-8-18(24)13-19(17)20)28-15-22(30)29-12-4-6-16-5-2-3-7-21(16)29/h2-3,5,7-9,13-14,27H,4,6,10-12,15H2,1H3,(H2,25,26,28) |
| InChIKey | FGTPUZBGKFVXQD-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 72.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.49 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|