C22H25FIN5O — CID 111972271
1-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]-3-[2-(5-fluoro-1H-indol-3-yl)ethyl]-2-methylguanidine;hydroiodide (PubChem CID 111972271) has the molecular formula C22H25FIN5O and a molecular weight of 521.38 g/mol. Its IUPAC name is 1-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]-3-[2-(5-fluoro-1H-indol-3-yl)ethyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]-3-[2-(5-fluoro-1H-indol-3-yl)ethyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111972271 |
| Molecular Formula | C22H25FIN5O |
| Molecular Weight | 521.38 g/mol |
| Exact Mass | 521.11 |
| IUPAC Name | 1-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]-3-[2-(5-fluoro-1H-indol-3-yl)ethyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(/NCCc1c[nH]c2ccc(F)cc12)NCC(=O)N1CCc2ccccc21.I |
| InChI | InChI=1S/C22H24FN5O.HI/c1-24-22(25-10-8-16-13-26-19-7-6-17(23)12-18(16)19)27-14-21(29)28-11-9-15-4-2-3-5-20(15)28;/h2-7,12-13,26H,8-11,14H2,1H3,(H2,24,25,27);1H |
| InChIKey | AISXZHJSWCXFOK-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 72.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.38 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|