C22H27FIN5O2S — CID 111972419
1-[2-(2,3-dihydroindol-1-ylsulfonyl)ethyl]-3-[2-(5-fluoro-1H-indol-3-yl)ethyl]-2-methylguanidine;hydroiodide (PubChem CID 111972419) has the molecular formula C22H27FIN5O2S and a molecular weight of 571.46 g/mol. Its IUPAC name is 1-[2-(2,3-dihydroindol-1-ylsulfonyl)ethyl]-3-[2-(5-fluoro-1H-indol-3-yl)ethyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[2-(2,3-dihydroindol-1-ylsulfonyl)ethyl]-3-[2-(5-fluoro-1H-indol-3-yl)ethyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111972419 |
| Molecular Formula | C22H27FIN5O2S |
| Molecular Weight | 571.46 g/mol |
| Exact Mass | 571.09 |
| IUPAC Name | 1-[2-(2,3-dihydroindol-1-ylsulfonyl)ethyl]-3-[2-(5-fluoro-1H-indol-3-yl)ethyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(/NCCc1c[nH]c2ccc(F)cc12)NCCS(=O)(=O)N1CCc2ccccc21.I |
| InChI | InChI=1S/C22H26FN5O2S.HI/c1-24-22(25-10-8-17-15-27-20-7-6-18(23)14-19(17)20)26-11-13-31(29,30)28-12-9-16-4-2-3-5-21(16)28;/h2-7,14-15,27H,8-13H2,1H3,(H2,24,25,26);1H |
| InChIKey | DHUGZWXVJJOKBI-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 89.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.46 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|