C20H31FIN5O3S — CID 111973139
1-[2-(2,6-dimethylmorpholin-4-yl)sulfonylethyl]-3-[2-(5-fluoro-1H-indol-3-yl)ethyl]-2-methylguanidine;hydroiodide (PubChem CID 111973139) has the molecular formula C20H31FIN5O3S and a molecular weight of 567.47 g/mol. Its IUPAC name is 1-[2-(2,6-dimethylmorpholin-4-yl)sulfonylethyl]-3-[2-(5-fluoro-1H-indol-3-yl)ethyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[2-(2,6-dimethylmorpholin-4-yl)sulfonylethyl]-3-[2-(5-fluoro-1H-indol-3-yl)ethyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111973139 |
| Molecular Formula | C20H31FIN5O3S |
| Molecular Weight | 567.47 g/mol |
| Exact Mass | 567.12 |
| IUPAC Name | 1-[2-(2,6-dimethylmorpholin-4-yl)sulfonylethyl]-3-[2-(5-fluoro-1H-indol-3-yl)ethyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(/NCCc1c[nH]c2ccc(F)cc12)NCCS(=O)(=O)N1CC(C)OC(C)C1.I |
| InChI | InChI=1S/C20H30FN5O3S.HI/c1-14-12-26(13-15(2)29-14)30(27,28)9-8-24-20(22-3)23-7-6-16-11-25-19-5-4-17(21)10-18(16)19;/h4-5,10-11,14-15,25H,6-9,12-13H2,1-3H3,(H2,22,23,24);1H |
| InChIKey | CKNQDMCURJXUPQ-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.47 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|