C23H22N4O — CID 99791369
2-(1H-indol-3-yl)-1-(4-isoquinolin-4-ylpiperazin-1-yl)ethanone (PubChem CID 99791369) has the molecular formula C23H22N4O and a molecular weight of 370.46 g/mol. Its IUPAC name is 2-(1H-indol-3-yl)-1-(4-isoquinolin-4-ylpiperazin-1-yl)ethanone.
| Compound Name | 2-(1H-indol-3-yl)-1-(4-isoquinolin-4-ylpiperazin-1-yl)ethanone |
|---|---|
| PubChem CID | 99791369 |
| Molecular Formula | C23H22N4O |
| Molecular Weight | 370.46 g/mol |
| Exact Mass | 370.18 |
| IUPAC Name | 2-(1H-indol-3-yl)-1-(4-isoquinolin-4-ylpiperazin-1-yl)ethanone |
| SMILES | O=C(Cc1c[nH]c2ccccc12)N1CCN(c2cncc3ccccc23)CC1 |
| InChI | InChI=1S/C23H22N4O/c28-23(13-18-15-25-21-8-4-3-6-19(18)21)27-11-9-26(10-12-27)22-16-24-14-17-5-1-2-7-20(17)22/h1-8,14-16,25H,9-13H2 |
| InChIKey | DKYGJXDPRSODOW-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 52.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.46 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |