C26H25N3O2S — CID 55810157
2-(1H-indol-3-yl)-1-[4-(2-naphthalen-2-ylsulfanylacetyl)piperazin-1-yl]ethanone (PubChem CID 55810157) has the molecular formula C26H25N3O2S and a molecular weight of 443.57 g/mol. Its IUPAC name is 2-(1H-indol-3-yl)-1-[4-(2-naphthalen-2-ylsulfanylacetyl)piperazin-1-yl]ethanone.
| Compound Name | 2-(1H-indol-3-yl)-1-[4-(2-naphthalen-2-ylsulfanylacetyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 55810157 |
| Molecular Formula | C26H25N3O2S |
| Molecular Weight | 443.57 g/mol |
| Exact Mass | 443.17 |
| IUPAC Name | 2-(1H-indol-3-yl)-1-[4-(2-naphthalen-2-ylsulfanylacetyl)piperazin-1-yl]ethanone |
| SMILES | O=C(CSc1ccc2ccccc2c1)N1CCN(C(=O)Cc2c[nH]c3ccccc23)CC1 |
| InChI | InChI=1S/C26H25N3O2S/c30-25(16-21-17-27-24-8-4-3-7-23(21)24)28-11-13-29(14-12-28)26(31)18-32-22-10-9-19-5-1-2-6-20(19)15-22/h1-10,15,17,27H,11-14,16,18H2 |
| InChIKey | TUBCSWQWDFBJJB-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 56.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.57 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |