C19H18F2N2O4S — CID 133480091
4-[(3,4-difluorophenyl)methylidene]-1-(3-methylsulfonyl-2-nitrophenyl)piperidine (PubChem CID 133480091) has the molecular formula C19H18F2N2O4S and a molecular weight of 408.43 g/mol. Its IUPAC name is 4-[(3,4-difluorophenyl)methylidene]-1-(3-methylsulfonyl-2-nitrophenyl)piperidine.
| Compound Name | 4-[(3,4-difluorophenyl)methylidene]-1-(3-methylsulfonyl-2-nitrophenyl)piperidine |
|---|---|
| PubChem CID | 133480091 |
| Molecular Formula | C19H18F2N2O4S |
| Molecular Weight | 408.43 g/mol |
| Exact Mass | 408.10 |
| IUPAC Name | 4-[(3,4-difluorophenyl)methylidene]-1-(3-methylsulfonyl-2-nitrophenyl)piperidine |
| SMILES | CS(=O)(=O)c1cccc(N2CCC(=Cc3ccc(F)c(F)c3)CC2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C19H18F2N2O4S/c1-28(26,27)18-4-2-3-17(19(18)23(24)25)22-9-7-13(8-10-22)11-14-5-6-15(20)16(21)12-14/h2-6,11-12H,7-10H2,1H3 |
| InChIKey | QDOVKJLDDKVXNF-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 80.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.43 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|