C17H16F2N2O4S2 — CID 133479976
4-[(3,4-difluorophenyl)methylidene]-1-(5-methylsulfonyl-3-nitrothiophen-2-yl)piperidine (PubChem CID 133479976) has the molecular formula C17H16F2N2O4S2 and a molecular weight of 414.46 g/mol. Its IUPAC name is 4-[(3,4-difluorophenyl)methylidene]-1-(5-methylsulfonyl-3-nitrothiophen-2-yl)piperidine.
| Compound Name | 4-[(3,4-difluorophenyl)methylidene]-1-(5-methylsulfonyl-3-nitrothiophen-2-yl)piperidine |
|---|---|
| PubChem CID | 133479976 |
| Molecular Formula | C17H16F2N2O4S2 |
| Molecular Weight | 414.46 g/mol |
| Exact Mass | 414.05 |
| IUPAC Name | 4-[(3,4-difluorophenyl)methylidene]-1-(5-methylsulfonyl-3-nitrothiophen-2-yl)piperidine |
| SMILES | CS(=O)(=O)c1cc([N+](=O)[O-])c(N2CCC(=Cc3ccc(F)c(F)c3)CC2)s1 |
| InChI | InChI=1S/C17H16F2N2O4S2/c1-27(24,25)16-10-15(21(22)23)17(26-16)20-6-4-11(5-7-20)8-12-2-3-13(18)14(19)9-12/h2-3,8-10H,4-7H2,1H3 |
| InChIKey | ZCHPGTMOGDOAHW-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 80.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.46 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|