C12H14N4O4S3 — CID 133440701
2-[4-(5-methylsulfonyl-3-nitrothiophen-2-yl)piperazin-1-yl]-1,3-thiazole (PubChem CID 133440701) has the molecular formula C12H14N4O4S3 and a molecular weight of 374.47 g/mol. Its IUPAC name is 2-[4-(5-methylsulfonyl-3-nitrothiophen-2-yl)piperazin-1-yl]-1,3-thiazole.
| Compound Name | 2-[4-(5-methylsulfonyl-3-nitrothiophen-2-yl)piperazin-1-yl]-1,3-thiazole |
|---|---|
| PubChem CID | 133440701 |
| Molecular Formula | C12H14N4O4S3 |
| Molecular Weight | 374.47 g/mol |
| Exact Mass | 374.02 |
| IUPAC Name | 2-[4-(5-methylsulfonyl-3-nitrothiophen-2-yl)piperazin-1-yl]-1,3-thiazole |
| SMILES | CS(=O)(=O)c1cc([N+](=O)[O-])c(N2CCN(c3nccs3)CC2)s1 |
| InChI | InChI=1S/C12H14N4O4S3/c1-23(19,20)10-8-9(16(17)18)11(22-10)14-3-5-15(6-4-14)12-13-2-7-21-12/h2,7-8H,3-6H2,1H3 |
| InChIKey | MSWHXAYKGCTCMZ-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 96.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.47 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|