C12H18N2O5S2 — CID 133441527
3-(methoxymethyl)-1-(5-methylsulfonyl-3-nitrothiophen-2-yl)piperidine (PubChem CID 133441527) has the molecular formula C12H18N2O5S2 and a molecular weight of 334.42 g/mol. Its IUPAC name is 3-(methoxymethyl)-1-(5-methylsulfonyl-3-nitrothiophen-2-yl)piperidine.
| Compound Name | 3-(methoxymethyl)-1-(5-methylsulfonyl-3-nitrothiophen-2-yl)piperidine |
|---|---|
| PubChem CID | 133441527 |
| Molecular Formula | C12H18N2O5S2 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.07 |
| IUPAC Name | 3-(methoxymethyl)-1-(5-methylsulfonyl-3-nitrothiophen-2-yl)piperidine |
| SMILES | COCC1CCCN(c2sc(S(C)(=O)=O)cc2[N+](=O)[O-])C1 |
| InChI | InChI=1S/C12H18N2O5S2/c1-19-8-9-4-3-5-13(7-9)12-10(14(15)16)6-11(20-12)21(2,17)18/h6,9H,3-5,7-8H2,1-2H3 |
| InChIKey | DKCNYSQCICOBOW-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 89.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|