C9H12N2O5S2 — CID 75397596
(3S)-1-(5-methylsulfonyl-3-nitrothiophen-2-yl)pyrrolidin-3-ol (PubChem CID 75397596) has the molecular formula C9H12N2O5S2 and a molecular weight of 292.34 g/mol. Its IUPAC name is (3S)-1-(5-methylsulfonyl-3-nitrothiophen-2-yl)pyrrolidin-3-ol.
| Compound Name | (3S)-1-(5-methylsulfonyl-3-nitrothiophen-2-yl)pyrrolidin-3-ol |
|---|---|
| PubChem CID | 75397596 |
| Molecular Formula | C9H12N2O5S2 |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.02 |
| IUPAC Name | (3S)-1-(5-methylsulfonyl-3-nitrothiophen-2-yl)pyrrolidin-3-ol |
| SMILES | CS(=O)(=O)c1cc([N+](=O)[O-])c(N2CC[C@H](O)C2)s1 |
| InChI | InChI=1S/C9H12N2O5S2/c1-18(15,16)8-4-7(11(13)14)9(17-8)10-3-2-6(12)5-10/h4,6,12H,2-3,5H2,1H3/t6-/m0/s1 |
| InChIKey | GYCQRXNSCNCQPB-LURJTMIESA-N |
| XLogP | 0.63 |
| TPSA | 100.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|