C10H14N2O5S2 — CID 133441267
[(2R)-1-(5-methylsulfonyl-3-nitrothiophen-2-yl)pyrrolidin-2-yl]methanol (PubChem CID 133441267) has the molecular formula C10H14N2O5S2 and a molecular weight of 306.37 g/mol. Its IUPAC name is [(2R)-1-(5-methylsulfonyl-3-nitrothiophen-2-yl)pyrrolidin-2-yl]methanol.
| Compound Name | [(2R)-1-(5-methylsulfonyl-3-nitrothiophen-2-yl)pyrrolidin-2-yl]methanol |
|---|---|
| PubChem CID | 133441267 |
| Molecular Formula | C10H14N2O5S2 |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.03 |
| IUPAC Name | [(2R)-1-(5-methylsulfonyl-3-nitrothiophen-2-yl)pyrrolidin-2-yl]methanol |
| SMILES | CS(=O)(=O)c1cc([N+](=O)[O-])c(N2CCC[C@@H]2CO)s1 |
| InChI | InChI=1S/C10H14N2O5S2/c1-19(16,17)9-5-8(12(14)15)10(18-9)11-4-2-3-7(11)6-13/h5,7,13H,2-4,6H2,1H3/t7-/m1/s1 |
| InChIKey | FZOWADUNSIKHIC-SSDOTTSWSA-N |
| XLogP | 1.02 |
| TPSA | 100.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|