C16H18N2O5S2 — CID 133440475
2-(4-methoxyphenyl)-1-(5-methylsulfonyl-3-nitrothiophen-2-yl)pyrrolidine (PubChem CID 133440475) has the molecular formula C16H18N2O5S2 and a molecular weight of 382.46 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)-1-(5-methylsulfonyl-3-nitrothiophen-2-yl)pyrrolidine.
| Compound Name | 2-(4-methoxyphenyl)-1-(5-methylsulfonyl-3-nitrothiophen-2-yl)pyrrolidine |
|---|---|
| PubChem CID | 133440475 |
| Molecular Formula | C16H18N2O5S2 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.07 |
| IUPAC Name | 2-(4-methoxyphenyl)-1-(5-methylsulfonyl-3-nitrothiophen-2-yl)pyrrolidine |
| SMILES | COc1ccc(C2CCCN2c2sc(S(C)(=O)=O)cc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C16H18N2O5S2/c1-23-12-7-5-11(6-8-12)13-4-3-9-17(13)16-14(18(19)20)10-15(24-16)25(2,21)22/h5-8,10,13H,3-4,9H2,1-2H3 |
| InChIKey | CACLTDRRTLYQLA-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 89.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|