C18H17F2N3O2 — CID 133480016
2-[4-[(3,4-difluorophenyl)methylidene]piperidin-1-yl]-4-methyl-5-nitropyridine (PubChem CID 133480016) has the molecular formula C18H17F2N3O2 and a molecular weight of 345.35 g/mol. Its IUPAC name is 2-[4-[(3,4-difluorophenyl)methylidene]piperidin-1-yl]-4-methyl-5-nitropyridine.
| Compound Name | 2-[4-[(3,4-difluorophenyl)methylidene]piperidin-1-yl]-4-methyl-5-nitropyridine |
|---|---|
| PubChem CID | 133480016 |
| Molecular Formula | C18H17F2N3O2 |
| Molecular Weight | 345.35 g/mol |
| Exact Mass | 345.13 |
| IUPAC Name | 2-[4-[(3,4-difluorophenyl)methylidene]piperidin-1-yl]-4-methyl-5-nitropyridine |
| SMILES | Cc1cc(N2CCC(=Cc3ccc(F)c(F)c3)CC2)ncc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H17F2N3O2/c1-12-8-18(21-11-17(12)23(24)25)22-6-4-13(5-7-22)9-14-2-3-15(19)16(20)10-14/h2-3,8-11H,4-7H2,1H3 |
| InChIKey | CVJPBGDMSIXCLD-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 59.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.35 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|