C15H12ClN3O2S — CID 71937312
8-chloro-2-(5-nitrothiophen-2-yl)-1,3,4,5-tetrahydropyrido[4,3-b]indole (PubChem CID 71937312) has the molecular formula C15H12ClN3O2S and a molecular weight of 333.80 g/mol. Its IUPAC name is 8-chloro-2-(5-nitrothiophen-2-yl)-1,3,4,5-tetrahydropyrido[4,3-b]indole.
| Compound Name | 8-chloro-2-(5-nitrothiophen-2-yl)-1,3,4,5-tetrahydropyrido[4,3-b]indole |
|---|---|
| PubChem CID | 71937312 |
| Molecular Formula | C15H12ClN3O2S |
| Molecular Weight | 333.80 g/mol |
| Exact Mass | 333.03 |
| IUPAC Name | 8-chloro-2-(5-nitrothiophen-2-yl)-1,3,4,5-tetrahydropyrido[4,3-b]indole |
| SMILES | O=[N+]([O-])c1ccc(N2CCc3[nH]c4ccc(Cl)cc4c3C2)s1 |
| InChI | InChI=1S/C15H12ClN3O2S/c16-9-1-2-12-10(7-9)11-8-18(6-5-13(11)17-12)14-3-4-15(22-14)19(20)21/h1-4,7,17H,5-6,8H2 |
| InChIKey | YEZWLFFBXQOFGO-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 62.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.80 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|