C15H17F3N6O4S — CID 169377380
5-[2-nitro-4-(trifluoromethylsulfonyl)phenyl]-1,3,5-triazaspiro[5.5]undeca-1,3-diene-2,4-diamine (PubChem CID 169377380) has the molecular formula C15H17F3N6O4S and a molecular weight of 434.40 g/mol. Its IUPAC name is 5-[2-nitro-4-(trifluoromethylsulfonyl)phenyl]-1,3,5-triazaspiro[5.5]undeca-1,3-diene-2,4-diamine.
| Compound Name | 5-[2-nitro-4-(trifluoromethylsulfonyl)phenyl]-1,3,5-triazaspiro[5.5]undeca-1,3-diene-2,4-diamine |
|---|---|
| PubChem CID | 169377380 |
| Molecular Formula | C15H17F3N6O4S |
| Molecular Weight | 434.40 g/mol |
| Exact Mass | 434.10 |
| IUPAC Name | 5-[2-nitro-4-(trifluoromethylsulfonyl)phenyl]-1,3,5-triazaspiro[5.5]undeca-1,3-diene-2,4-diamine |
| SMILES | NC1=NC2(CCCCC2)N(c2ccc(S(=O)(=O)C(F)(F)F)cc2[N+](=O)[O-])C(N)=N1 |
| InChI | InChI=1S/C15H17F3N6O4S/c16-15(17,18)29(27,28)9-4-5-10(11(8-9)24(25)26)23-13(20)21-12(19)22-14(23)6-2-1-3-7-14/h4-5,8H,1-3,6-7H2,(H4,19,20,21,22) |
| InChIKey | CRWWWHANKGOYOZ-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 157.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.40 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|