C15H19FN6O2 — CID 169373938
5-(4-fluoro-2-methyl-6-nitrophenyl)-1,3,5-triazaspiro[5.5]undeca-1,3-diene-2,4-diamine (PubChem CID 169373938) has the molecular formula C15H19FN6O2 and a molecular weight of 334.36 g/mol. Its IUPAC name is 5-(4-fluoro-2-methyl-6-nitrophenyl)-1,3,5-triazaspiro[5.5]undeca-1,3-diene-2,4-diamine.
| Compound Name | 5-(4-fluoro-2-methyl-6-nitrophenyl)-1,3,5-triazaspiro[5.5]undeca-1,3-diene-2,4-diamine |
|---|---|
| PubChem CID | 169373938 |
| Molecular Formula | C15H19FN6O2 |
| Molecular Weight | 334.36 g/mol |
| Exact Mass | 334.16 |
| IUPAC Name | 5-(4-fluoro-2-methyl-6-nitrophenyl)-1,3,5-triazaspiro[5.5]undeca-1,3-diene-2,4-diamine |
| SMILES | Cc1cc(F)cc([N+](=O)[O-])c1N1C(N)=NC(N)=NC12CCCCC2 |
| InChI | InChI=1S/C15H19FN6O2/c1-9-7-10(16)8-11(22(23)24)12(9)21-14(18)19-13(17)20-15(21)5-3-2-4-6-15/h7-8H,2-6H2,1H3,(H4,17,18,19,20) |
| InChIKey | MUTMTHJSWWOUCC-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 123.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.36 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|