C17H22N6O4 — CID 169376618
5-(7-nitro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)-1,3,5-triazaspiro[5.5]undeca-1,3-diene-2,4-diamine (PubChem CID 169376618) has the molecular formula C17H22N6O4 and a molecular weight of 374.40 g/mol. Its IUPAC name is 5-(7-nitro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)-1,3,5-triazaspiro[5.5]undeca-1,3-diene-2,4-diamine.
| Compound Name | 5-(7-nitro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)-1,3,5-triazaspiro[5.5]undeca-1,3-diene-2,4-diamine |
|---|---|
| PubChem CID | 169376618 |
| Molecular Formula | C17H22N6O4 |
| Molecular Weight | 374.40 g/mol |
| Exact Mass | 374.17 |
| IUPAC Name | 5-(7-nitro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)-1,3,5-triazaspiro[5.5]undeca-1,3-diene-2,4-diamine |
| SMILES | NC1=NC2(CCCCC2)N(c2cc3c(cc2[N+](=O)[O-])OCCCO3)C(N)=N1 |
| InChI | InChI=1S/C17H22N6O4/c18-15-20-16(19)22(17(21-15)5-2-1-3-6-17)11-9-13-14(10-12(11)23(24)25)27-8-4-7-26-13/h9-10H,1-8H2,(H4,18,19,20,21) |
| InChIKey | JKALOMLBXWLDKA-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 141.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.40 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|