C21H22N6O3 — CID 169377993
[4-(2,4-diamino-1,3,5-triazaspiro[5.5]undeca-1,3-dien-5-yl)-3-nitrophenyl]-phenylmethanone (PubChem CID 169377993) has the molecular formula C21H22N6O3 and a molecular weight of 406.45 g/mol. Its IUPAC name is [4-(2,4-diamino-1,3,5-triazaspiro[5.5]undeca-1,3-dien-5-yl)-3-nitrophenyl]-phenylmethanone.
| Compound Name | [4-(2,4-diamino-1,3,5-triazaspiro[5.5]undeca-1,3-dien-5-yl)-3-nitrophenyl]-phenylmethanone |
|---|---|
| PubChem CID | 169377993 |
| Molecular Formula | C21H22N6O3 |
| Molecular Weight | 406.45 g/mol |
| Exact Mass | 406.18 |
| IUPAC Name | [4-(2,4-diamino-1,3,5-triazaspiro[5.5]undeca-1,3-dien-5-yl)-3-nitrophenyl]-phenylmethanone |
| SMILES | NC1=NC2(CCCCC2)N(c2ccc(C(=O)c3ccccc3)cc2[N+](=O)[O-])C(N)=N1 |
| InChI | InChI=1S/C21H22N6O3/c22-19-24-20(23)26(21(25-19)11-5-2-6-12-21)16-10-9-15(13-17(16)27(29)30)18(28)14-7-3-1-4-8-14/h1,3-4,7-10,13H,2,5-6,11-12H2,(H4,22,23,24,25) |
| InChIKey | OWZUYTRYHSSGFR-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 140.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.45 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|