C14H17ClN6O3 — CID 169378112
4-chloro-2-(2,4-diamino-1,3,5-triazaspiro[5.5]undeca-1,3-dien-5-yl)-5-nitrophenol (PubChem CID 169378112) has the molecular formula C14H17ClN6O3 and a molecular weight of 352.78 g/mol. Its IUPAC name is 4-chloro-2-(2,4-diamino-1,3,5-triazaspiro[5.5]undeca-1,3-dien-5-yl)-5-nitrophenol.
| Compound Name | 4-chloro-2-(2,4-diamino-1,3,5-triazaspiro[5.5]undeca-1,3-dien-5-yl)-5-nitrophenol |
|---|---|
| PubChem CID | 169378112 |
| Molecular Formula | C14H17ClN6O3 |
| Molecular Weight | 352.78 g/mol |
| Exact Mass | 352.11 |
| IUPAC Name | 4-chloro-2-(2,4-diamino-1,3,5-triazaspiro[5.5]undeca-1,3-dien-5-yl)-5-nitrophenol |
| SMILES | NC1=NC2(CCCCC2)N(c2cc(Cl)c([N+](=O)[O-])cc2O)C(N)=N1 |
| InChI | InChI=1S/C14H17ClN6O3/c15-8-6-10(11(22)7-9(8)21(23)24)20-13(17)18-12(16)19-14(20)4-2-1-3-5-14/h6-7,22H,1-5H2,(H4,16,17,18,19) |
| InChIKey | VHGWPIKULJBYMQ-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 143.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.78 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|