C20H19Cl3N6O3 — CID 169375660
5-[4-chloro-5-(2,3-dichlorophenoxy)-2-nitrophenyl]-1,3,5-triazaspiro[5.5]undeca-1,3-diene-2,4-diamine (PubChem CID 169375660) has the molecular formula C20H19Cl3N6O3 and a molecular weight of 497.77 g/mol. Its IUPAC name is 5-[4-chloro-5-(2,3-dichlorophenoxy)-2-nitrophenyl]-1,3,5-triazaspiro[5.5]undeca-1,3-diene-2,4-diamine.
| Compound Name | 5-[4-chloro-5-(2,3-dichlorophenoxy)-2-nitrophenyl]-1,3,5-triazaspiro[5.5]undeca-1,3-diene-2,4-diamine |
|---|---|
| PubChem CID | 169375660 |
| Molecular Formula | C20H19Cl3N6O3 |
| Molecular Weight | 497.77 g/mol |
| Exact Mass | 496.06 |
| IUPAC Name | 5-[4-chloro-5-(2,3-dichlorophenoxy)-2-nitrophenyl]-1,3,5-triazaspiro[5.5]undeca-1,3-diene-2,4-diamine |
| SMILES | NC1=NC2(CCCCC2)N(c2cc(Oc3cccc(Cl)c3Cl)c(Cl)cc2[N+](=O)[O-])C(N)=N1 |
| InChI | InChI=1S/C20H19Cl3N6O3/c21-11-5-4-6-15(17(11)23)32-16-10-13(14(29(30)31)9-12(16)22)28-19(25)26-18(24)27-20(28)7-2-1-3-8-20/h4-6,9-10H,1-3,7-8H2,(H4,24,25,26,27) |
| InChIKey | FJAJYNZEUDCILM-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 132.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.77 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|