C17H23N7O2 — CID 169375104
5-[3-nitro-4-(prop-2-enylamino)phenyl]-1,3,5-triazaspiro[5.5]undeca-1,3-diene-2,4-diamine (PubChem CID 169375104) has the molecular formula C17H23N7O2 and a molecular weight of 357.42 g/mol. Its IUPAC name is 5-[3-nitro-4-(prop-2-enylamino)phenyl]-1,3,5-triazaspiro[5.5]undeca-1,3-diene-2,4-diamine.
| Compound Name | 5-[3-nitro-4-(prop-2-enylamino)phenyl]-1,3,5-triazaspiro[5.5]undeca-1,3-diene-2,4-diamine |
|---|---|
| PubChem CID | 169375104 |
| Molecular Formula | C17H23N7O2 |
| Molecular Weight | 357.42 g/mol |
| Exact Mass | 357.19 |
| IUPAC Name | 5-[3-nitro-4-(prop-2-enylamino)phenyl]-1,3,5-triazaspiro[5.5]undeca-1,3-diene-2,4-diamine |
| SMILES | C=CCNc1ccc(N2C(N)=NC(N)=NC23CCCCC3)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H23N7O2/c1-2-10-20-13-7-6-12(11-14(13)24(25)26)23-16(19)21-15(18)22-17(23)8-4-3-5-9-17/h2,6-7,11,20H,1,3-5,8-10H2,(H4,18,19,21,22) |
| InChIKey | AOMQIFUSXBQEQJ-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 135.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.42 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|