C17H26N6O4S — CID 169376957
5-(2,4-diamino-1,3,5-triazaspiro[5.5]undeca-1,3-dien-5-yl)-2-[(2-hydroxyethylamino)methyl]benzenesulfonic acid (PubChem CID 169376957) has the molecular formula C17H26N6O4S and a molecular weight of 410.50 g/mol. Its IUPAC name is 5-(2,4-diamino-1,3,5-triazaspiro[5.5]undeca-1,3-dien-5-yl)-2-[(2-hydroxyethylamino)methyl]benzenesulfonic acid.
| Compound Name | 5-(2,4-diamino-1,3,5-triazaspiro[5.5]undeca-1,3-dien-5-yl)-2-[(2-hydroxyethylamino)methyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 169376957 |
| Molecular Formula | C17H26N6O4S |
| Molecular Weight | 410.50 g/mol |
| Exact Mass | 410.17 |
| IUPAC Name | 5-(2,4-diamino-1,3,5-triazaspiro[5.5]undeca-1,3-dien-5-yl)-2-[(2-hydroxyethylamino)methyl]benzenesulfonic acid |
| SMILES | NC1=NC2(CCCCC2)N(c2ccc(CNCCO)c(S(=O)(=O)O)c2)C(N)=N1 |
| InChI | InChI=1S/C17H26N6O4S/c18-15-21-16(19)23(17(22-15)6-2-1-3-7-17)13-5-4-12(11-20-8-9-24)14(10-13)28(25,26)27/h4-5,10,20,24H,1-3,6-9,11H2,(H,25,26,27)(H4,18,19,21,22) |
| InChIKey | QINPOXBBCALEJR-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 166.63 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.50 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|