C9H14N2O4S — CID 124926063
5-amino-2-[(2-hydroxyethylamino)methyl]benzenesulfonic acid (PubChem CID 124926063) has the molecular formula C9H14N2O4S and a molecular weight of 246.29 g/mol. Its IUPAC name is 5-amino-2-[(2-hydroxyethylamino)methyl]benzenesulfonic acid.
| Compound Name | 5-amino-2-[(2-hydroxyethylamino)methyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 124926063 |
| Molecular Formula | C9H14N2O4S |
| Molecular Weight | 246.29 g/mol |
| Exact Mass | 246.07 |
| IUPAC Name | 5-amino-2-[(2-hydroxyethylamino)methyl]benzenesulfonic acid |
| SMILES | Nc1ccc(CNCCO)c(S(=O)(=O)O)c1 |
| InChI | InChI=1S/C9H14N2O4S/c10-8-2-1-7(6-11-3-4-12)9(5-8)16(13,14)15/h1-2,5,11-12H,3-4,6,10H2,(H,13,14,15) |
| InChIKey | FZYADNXLGVJFMF-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.29 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|