C11H19N3O3S — CID 54305899
5-amino-2-(5-aminopentylamino)benzenesulfonic acid (PubChem CID 54305899) has the molecular formula C11H19N3O3S and a molecular weight of 273.36 g/mol. Its IUPAC name is 5-amino-2-(5-aminopentylamino)benzenesulfonic acid.
| Compound Name | 5-amino-2-(5-aminopentylamino)benzenesulfonic acid |
|---|---|
| PubChem CID | 54305899 |
| Molecular Formula | C11H19N3O3S |
| Molecular Weight | 273.36 g/mol |
| Exact Mass | 273.11 |
| IUPAC Name | 5-amino-2-(5-aminopentylamino)benzenesulfonic acid |
| SMILES | NCCCCCNc1ccc(N)cc1S(=O)(=O)O |
| InChI | InChI=1S/C11H19N3O3S/c12-6-2-1-3-7-14-10-5-4-9(13)8-11(10)18(15,16)17/h4-5,8,14H,1-3,6-7,12-13H2,(H,15,16,17) |
| InChIKey | SHLWYTWTAOXXKC-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 118.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.36 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|