C14H18ClN5O3S — CID 169378350
2-chloro-5-(2,4-diamino-1,3,5-triazaspiro[5.5]undeca-1,3-dien-5-yl)benzenesulfonic acid (PubChem CID 169378350) has the molecular formula C14H18ClN5O3S and a molecular weight of 371.85 g/mol. Its IUPAC name is 2-chloro-5-(2,4-diamino-1,3,5-triazaspiro[5.5]undeca-1,3-dien-5-yl)benzenesulfonic acid.
| Compound Name | 2-chloro-5-(2,4-diamino-1,3,5-triazaspiro[5.5]undeca-1,3-dien-5-yl)benzenesulfonic acid |
|---|---|
| PubChem CID | 169378350 |
| Molecular Formula | C14H18ClN5O3S |
| Molecular Weight | 371.85 g/mol |
| Exact Mass | 371.08 |
| IUPAC Name | 2-chloro-5-(2,4-diamino-1,3,5-triazaspiro[5.5]undeca-1,3-dien-5-yl)benzenesulfonic acid |
| SMILES | NC1=NC2(CCCCC2)N(c2ccc(Cl)c(S(=O)(=O)O)c2)C(N)=N1 |
| InChI | InChI=1S/C14H18ClN5O3S/c15-10-5-4-9(8-11(10)24(21,22)23)20-13(17)18-12(16)19-14(20)6-2-1-3-7-14/h4-5,8H,1-3,6-7H2,(H,21,22,23)(H4,16,17,18,19) |
| InChIKey | UCXDCTBTETWERJ-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 134.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.85 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|