C15H21N5O4S — CID 169376953
2-(2,4-diamino-1,3,5-triazaspiro[5.5]undeca-1,3-dien-5-yl)-4-methoxybenzenesulfonic acid (PubChem CID 169376953) has the molecular formula C15H21N5O4S and a molecular weight of 367.43 g/mol. Its IUPAC name is 2-(2,4-diamino-1,3,5-triazaspiro[5.5]undeca-1,3-dien-5-yl)-4-methoxybenzenesulfonic acid.
| Compound Name | 2-(2,4-diamino-1,3,5-triazaspiro[5.5]undeca-1,3-dien-5-yl)-4-methoxybenzenesulfonic acid |
|---|---|
| PubChem CID | 169376953 |
| Molecular Formula | C15H21N5O4S |
| Molecular Weight | 367.43 g/mol |
| Exact Mass | 367.13 |
| IUPAC Name | 2-(2,4-diamino-1,3,5-triazaspiro[5.5]undeca-1,3-dien-5-yl)-4-methoxybenzenesulfonic acid |
| SMILES | COc1ccc(S(=O)(=O)O)c(N2C(N)=NC(N)=NC23CCCCC3)c1 |
| InChI | InChI=1S/C15H21N5O4S/c1-24-10-5-6-12(25(21,22)23)11(9-10)20-14(17)18-13(16)19-15(20)7-3-2-4-8-15/h5-6,9H,2-4,7-8H2,1H3,(H,21,22,23)(H4,16,17,18,19) |
| InChIKey | SHBYPOIRYJJUGR-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 143.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.43 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|