C23H26ClN5O3 — CID 169374258
(4-chlorophenyl)-[2-(2,4-diamino-1,3,5-triazaspiro[5.5]undeca-1,3-dien-5-yl)-4,5-dimethoxyphenyl]methanone (PubChem CID 169374258) has the molecular formula C23H26ClN5O3 and a molecular weight of 455.95 g/mol. Its IUPAC name is (4-chlorophenyl)-[2-(2,4-diamino-1,3,5-triazaspiro[5.5]undeca-1,3-dien-5-yl)-4,5-dimethoxyphenyl]methanone.
| Compound Name | (4-chlorophenyl)-[2-(2,4-diamino-1,3,5-triazaspiro[5.5]undeca-1,3-dien-5-yl)-4,5-dimethoxyphenyl]methanone |
|---|---|
| PubChem CID | 169374258 |
| Molecular Formula | C23H26ClN5O3 |
| Molecular Weight | 455.95 g/mol |
| Exact Mass | 455.17 |
| IUPAC Name | (4-chlorophenyl)-[2-(2,4-diamino-1,3,5-triazaspiro[5.5]undeca-1,3-dien-5-yl)-4,5-dimethoxyphenyl]methanone |
| SMILES | COc1cc(C(=O)c2ccc(Cl)cc2)c(N2C(N)=NC(N)=NC23CCCCC3)cc1OC |
| InChI | InChI=1S/C23H26ClN5O3/c1-31-18-12-16(20(30)14-6-8-15(24)9-7-14)17(13-19(18)32-2)29-22(26)27-21(25)28-23(29)10-4-3-5-11-23/h6-9,12-13H,3-5,10-11H2,1-2H3,(H4,25,26,27,28) |
| InChIKey | SCKBADQOXUZKAT-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 115.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.95 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |