C16H19ClIN5O2 — CID 169378101
methyl 5-chloro-2-(2,4-diamino-1,3,5-triazaspiro[5.5]undeca-1,3-dien-5-yl)-3-iodobenzoate (PubChem CID 169378101) has the molecular formula C16H19ClIN5O2 and a molecular weight of 475.72 g/mol. Its IUPAC name is methyl 5-chloro-2-(2,4-diamino-1,3,5-triazaspiro[5.5]undeca-1,3-dien-5-yl)-3-iodobenzoate.
| Compound Name | methyl 5-chloro-2-(2,4-diamino-1,3,5-triazaspiro[5.5]undeca-1,3-dien-5-yl)-3-iodobenzoate |
|---|---|
| PubChem CID | 169378101 |
| Molecular Formula | C16H19ClIN5O2 |
| Molecular Weight | 475.72 g/mol |
| Exact Mass | 475.03 |
| IUPAC Name | methyl 5-chloro-2-(2,4-diamino-1,3,5-triazaspiro[5.5]undeca-1,3-dien-5-yl)-3-iodobenzoate |
| SMILES | COC(=O)c1cc(Cl)cc(I)c1N1C(N)=NC(N)=NC12CCCCC2 |
| InChI | InChI=1S/C16H19ClIN5O2/c1-25-13(24)10-7-9(17)8-11(18)12(10)23-15(20)21-14(19)22-16(23)5-3-2-4-6-16/h7-8H,2-6H2,1H3,(H4,19,20,21,22) |
| InChIKey | XORAUPBGVIIHON-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 106.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.72 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|