C17H22IN5O2 — CID 169373670
ethyl 2-(2,4-diamino-1,3,5-triazaspiro[5.5]undeca-1,3-dien-5-yl)-5-iodobenzoate (PubChem CID 169373670) has the molecular formula C17H22IN5O2 and a molecular weight of 455.30 g/mol. Its IUPAC name is ethyl 2-(2,4-diamino-1,3,5-triazaspiro[5.5]undeca-1,3-dien-5-yl)-5-iodobenzoate.
| Compound Name | ethyl 2-(2,4-diamino-1,3,5-triazaspiro[5.5]undeca-1,3-dien-5-yl)-5-iodobenzoate |
|---|---|
| PubChem CID | 169373670 |
| Molecular Formula | C17H22IN5O2 |
| Molecular Weight | 455.30 g/mol |
| Exact Mass | 455.08 |
| IUPAC Name | ethyl 2-(2,4-diamino-1,3,5-triazaspiro[5.5]undeca-1,3-dien-5-yl)-5-iodobenzoate |
| SMILES | CCOC(=O)c1cc(I)ccc1N1C(N)=NC(N)=NC12CCCCC2 |
| InChI | InChI=1S/C17H22IN5O2/c1-2-25-14(24)12-10-11(18)6-7-13(12)23-16(20)21-15(19)22-17(23)8-4-3-5-9-17/h6-7,10H,2-5,8-9H2,1H3,(H4,19,20,21,22) |
| InChIKey | JLWUBLYTALQKCY-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 106.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.30 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|