C15H18IN5O2 — CID 169373966
2-(2,4-diamino-1,3,5-triazaspiro[5.5]undeca-1,3-dien-5-yl)-5-iodobenzoic acid (PubChem CID 169373966) has the molecular formula C15H18IN5O2 and a molecular weight of 427.25 g/mol. Its IUPAC name is 2-(2,4-diamino-1,3,5-triazaspiro[5.5]undeca-1,3-dien-5-yl)-5-iodobenzoic acid.
| Compound Name | 2-(2,4-diamino-1,3,5-triazaspiro[5.5]undeca-1,3-dien-5-yl)-5-iodobenzoic acid |
|---|---|
| PubChem CID | 169373966 |
| Molecular Formula | C15H18IN5O2 |
| Molecular Weight | 427.25 g/mol |
| Exact Mass | 427.05 |
| IUPAC Name | 2-(2,4-diamino-1,3,5-triazaspiro[5.5]undeca-1,3-dien-5-yl)-5-iodobenzoic acid |
| SMILES | NC1=NC2(CCCCC2)N(c2ccc(I)cc2C(=O)O)C(N)=N1 |
| InChI | InChI=1S/C15H18IN5O2/c16-9-4-5-11(10(8-9)12(22)23)21-14(18)19-13(17)20-15(21)6-2-1-3-7-15/h4-5,8H,1-3,6-7H2,(H,22,23)(H4,17,18,19,20) |
| InChIKey | SGIJTQWPJDLUHN-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 117.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.25 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|