C16H23N5O2S — CID 169376348
2-(2,4-diamino-1,3,5-triazaspiro[5.5]undeca-1,3-dien-5-yl)-4,5-dimethoxybenzenethiol (PubChem CID 169376348) has the molecular formula C16H23N5O2S and a molecular weight of 349.46 g/mol. Its IUPAC name is 2-(2,4-diamino-1,3,5-triazaspiro[5.5]undeca-1,3-dien-5-yl)-4,5-dimethoxybenzenethiol.
| Compound Name | 2-(2,4-diamino-1,3,5-triazaspiro[5.5]undeca-1,3-dien-5-yl)-4,5-dimethoxybenzenethiol |
|---|---|
| PubChem CID | 169376348 |
| Molecular Formula | C16H23N5O2S |
| Molecular Weight | 349.46 g/mol |
| Exact Mass | 349.16 |
| IUPAC Name | 2-(2,4-diamino-1,3,5-triazaspiro[5.5]undeca-1,3-dien-5-yl)-4,5-dimethoxybenzenethiol |
| SMILES | COc1cc(S)c(N2C(N)=NC(N)=NC23CCCCC3)cc1OC |
| InChI | InChI=1S/C16H23N5O2S/c1-22-11-8-10(13(24)9-12(11)23-2)21-15(18)19-14(17)20-16(21)6-4-3-5-7-16/h8-9,24H,3-7H2,1-2H3,(H4,17,18,19,20) |
| InChIKey | HASXBHSGXRPJNA-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 98.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.46 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|