C16H23N5O2 — CID 169374746
5-[2-(methoxymethoxy)phenyl]-1,3,5-triazaspiro[5.5]undeca-1,3-diene-2,4-diamine (PubChem CID 169374746) has the molecular formula C16H23N5O2 and a molecular weight of 317.39 g/mol. Its IUPAC name is 5-[2-(methoxymethoxy)phenyl]-1,3,5-triazaspiro[5.5]undeca-1,3-diene-2,4-diamine.
| Compound Name | 5-[2-(methoxymethoxy)phenyl]-1,3,5-triazaspiro[5.5]undeca-1,3-diene-2,4-diamine |
|---|---|
| PubChem CID | 169374746 |
| Molecular Formula | C16H23N5O2 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.19 |
| IUPAC Name | 5-[2-(methoxymethoxy)phenyl]-1,3,5-triazaspiro[5.5]undeca-1,3-diene-2,4-diamine |
| SMILES | COCOc1ccccc1N1C(N)=NC(N)=NC12CCCCC2 |
| InChI | InChI=1S/C16H23N5O2/c1-22-11-23-13-8-4-3-7-12(13)21-15(18)19-14(17)20-16(21)9-5-2-6-10-16/h3-4,7-8H,2,5-6,9-11H2,1H3,(H4,17,18,19,20) |
| InChIKey | CDWZCWLWFZFEND-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 98.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|