C19H25N7 — CID 169375035
5-[2-(3,5-dimethylpyrazol-1-yl)phenyl]-1,3,5-triazaspiro[5.5]undeca-1,3-diene-2,4-diamine (PubChem CID 169375035) has the molecular formula C19H25N7 and a molecular weight of 351.46 g/mol. Its IUPAC name is 5-[2-(3,5-dimethylpyrazol-1-yl)phenyl]-1,3,5-triazaspiro[5.5]undeca-1,3-diene-2,4-diamine.
| Compound Name | 5-[2-(3,5-dimethylpyrazol-1-yl)phenyl]-1,3,5-triazaspiro[5.5]undeca-1,3-diene-2,4-diamine |
|---|---|
| PubChem CID | 169375035 |
| Molecular Formula | C19H25N7 |
| Molecular Weight | 351.46 g/mol |
| Exact Mass | 351.22 |
| IUPAC Name | 5-[2-(3,5-dimethylpyrazol-1-yl)phenyl]-1,3,5-triazaspiro[5.5]undeca-1,3-diene-2,4-diamine |
| SMILES | Cc1cc(C)n(-c2ccccc2N2C(N)=NC(N)=NC23CCCCC3)n1 |
| InChI | InChI=1S/C19H25N7/c1-13-12-14(2)26(24-13)16-9-5-4-8-15(16)25-18(21)22-17(20)23-19(25)10-6-3-7-11-19/h4-5,8-9,12H,3,6-7,10-11H2,1-2H3,(H4,20,21,22,23) |
| InChIKey | MMNOZNBYLDMAIW-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 97.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.46 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |