C19H24ClN7 — CID 169377522
5-[2-(4-chloro-3,5-dimethylpyrazol-1-yl)phenyl]-1,3,5-triazaspiro[5.5]undeca-1,3-diene-2,4-diamine (PubChem CID 169377522) has the molecular formula C19H24ClN7 and a molecular weight of 385.90 g/mol. Its IUPAC name is 5-[2-(4-chloro-3,5-dimethylpyrazol-1-yl)phenyl]-1,3,5-triazaspiro[5.5]undeca-1,3-diene-2,4-diamine.
| Compound Name | 5-[2-(4-chloro-3,5-dimethylpyrazol-1-yl)phenyl]-1,3,5-triazaspiro[5.5]undeca-1,3-diene-2,4-diamine |
|---|---|
| PubChem CID | 169377522 |
| Molecular Formula | C19H24ClN7 |
| Molecular Weight | 385.90 g/mol |
| Exact Mass | 385.18 |
| IUPAC Name | 5-[2-(4-chloro-3,5-dimethylpyrazol-1-yl)phenyl]-1,3,5-triazaspiro[5.5]undeca-1,3-diene-2,4-diamine |
| SMILES | Cc1nn(-c2ccccc2N2C(N)=NC(N)=NC23CCCCC3)c(C)c1Cl |
| InChI | InChI=1S/C19H24ClN7/c1-12-16(20)13(2)27(25-12)15-9-5-4-8-14(15)26-18(22)23-17(21)24-19(26)10-6-3-7-11-19/h4-5,8-9H,3,6-7,10-11H2,1-2H3,(H4,21,22,23,24) |
| InChIKey | JBYPUXDCVFCKTO-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 97.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.90 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |