C17H24N6O2S — CID 169378035
2-(2,4-diamino-1,3,5-triazaspiro[5.5]undeca-1,3-dien-5-yl)-4,5-dimethoxybenzenecarbothioamide (PubChem CID 169378035) has the molecular formula C17H24N6O2S and a molecular weight of 376.49 g/mol. Its IUPAC name is 2-(2,4-diamino-1,3,5-triazaspiro[5.5]undeca-1,3-dien-5-yl)-4,5-dimethoxybenzenecarbothioamide.
| Compound Name | 2-(2,4-diamino-1,3,5-triazaspiro[5.5]undeca-1,3-dien-5-yl)-4,5-dimethoxybenzenecarbothioamide |
|---|---|
| PubChem CID | 169378035 |
| Molecular Formula | C17H24N6O2S |
| Molecular Weight | 376.49 g/mol |
| Exact Mass | 376.17 |
| IUPAC Name | 2-(2,4-diamino-1,3,5-triazaspiro[5.5]undeca-1,3-dien-5-yl)-4,5-dimethoxybenzenecarbothioamide |
| SMILES | COc1cc(C(N)=S)c(N2C(N)=NC(N)=NC23CCCCC3)cc1OC |
| InChI | InChI=1S/C17H24N6O2S/c1-24-12-8-10(14(18)26)11(9-13(12)25-2)23-16(20)21-15(19)22-17(23)6-4-3-5-7-17/h8-9H,3-7H2,1-2H3,(H2,18,26)(H4,19,20,21,22) |
| InChIKey | UVSQAQADFIBWDR-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 124.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.49 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|