C22H26N6O4S — CID 169376902
5-(4-acetamidophenyl)-2-(2,4-diamino-1,3,5-triazaspiro[5.5]undeca-1,3-dien-5-yl)benzenesulfonic acid (PubChem CID 169376902) has the molecular formula C22H26N6O4S and a molecular weight of 470.56 g/mol. Its IUPAC name is 5-(4-acetamidophenyl)-2-(2,4-diamino-1,3,5-triazaspiro[5.5]undeca-1,3-dien-5-yl)benzenesulfonic acid.
| Compound Name | 5-(4-acetamidophenyl)-2-(2,4-diamino-1,3,5-triazaspiro[5.5]undeca-1,3-dien-5-yl)benzenesulfonic acid |
|---|---|
| PubChem CID | 169376902 |
| Molecular Formula | C22H26N6O4S |
| Molecular Weight | 470.56 g/mol |
| Exact Mass | 470.17 |
| IUPAC Name | 5-(4-acetamidophenyl)-2-(2,4-diamino-1,3,5-triazaspiro[5.5]undeca-1,3-dien-5-yl)benzenesulfonic acid |
| SMILES | CC(=O)Nc1ccc(-c2ccc(N3C(N)=NC(N)=NC34CCCCC4)c(S(=O)(=O)O)c2)cc1 |
| InChI | InChI=1S/C22H26N6O4S/c1-14(29)25-17-8-5-15(6-9-17)16-7-10-18(19(13-16)33(30,31)32)28-21(24)26-20(23)27-22(28)11-3-2-4-12-22/h5-10,13H,2-4,11-12H2,1H3,(H,25,29)(H,30,31,32)(H4,23,24,26,27) |
| InChIKey | OGNJJWAKACQIOX-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 163.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.56 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|