C20H24N6O3S — CID 169376904
2-(2,4-diamino-1,3,5-triazaspiro[5.5]undeca-1,3-dien-5-yl)-N-(4-hydroxyphenyl)benzenesulfonamide (PubChem CID 169376904) has the molecular formula C20H24N6O3S and a molecular weight of 428.52 g/mol. Its IUPAC name is 2-(2,4-diamino-1,3,5-triazaspiro[5.5]undeca-1,3-dien-5-yl)-N-(4-hydroxyphenyl)benzenesulfonamide.
| Compound Name | 2-(2,4-diamino-1,3,5-triazaspiro[5.5]undeca-1,3-dien-5-yl)-N-(4-hydroxyphenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 169376904 |
| Molecular Formula | C20H24N6O3S |
| Molecular Weight | 428.52 g/mol |
| Exact Mass | 428.16 |
| IUPAC Name | 2-(2,4-diamino-1,3,5-triazaspiro[5.5]undeca-1,3-dien-5-yl)-N-(4-hydroxyphenyl)benzenesulfonamide |
| SMILES | NC1=NC2(CCCCC2)N(c2ccccc2S(=O)(=O)Nc2ccc(O)cc2)C(N)=N1 |
| InChI | InChI=1S/C20H24N6O3S/c21-18-23-19(22)26(20(24-18)12-4-1-5-13-20)16-6-2-3-7-17(16)30(28,29)25-14-8-10-15(27)11-9-14/h2-3,6-11,25,27H,1,4-5,12-13H2,(H4,21,22,23,24) |
| InChIKey | WSKRYLBZCUJBLM-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 146.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.52 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulfonamide_B(41)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|