C20H23N5O4S — CID 169376891
3-(2,4-diamino-1,3,5-triazaspiro[5.5]undeca-1,3-dien-5-yl)-4-hydroxy-5-phenylbenzenesulfonic acid (PubChem CID 169376891) has the molecular formula C20H23N5O4S and a molecular weight of 429.50 g/mol. Its IUPAC name is 3-(2,4-diamino-1,3,5-triazaspiro[5.5]undeca-1,3-dien-5-yl)-4-hydroxy-5-phenylbenzenesulfonic acid.
| Compound Name | 3-(2,4-diamino-1,3,5-triazaspiro[5.5]undeca-1,3-dien-5-yl)-4-hydroxy-5-phenylbenzenesulfonic acid |
|---|---|
| PubChem CID | 169376891 |
| Molecular Formula | C20H23N5O4S |
| Molecular Weight | 429.50 g/mol |
| Exact Mass | 429.15 |
| IUPAC Name | 3-(2,4-diamino-1,3,5-triazaspiro[5.5]undeca-1,3-dien-5-yl)-4-hydroxy-5-phenylbenzenesulfonic acid |
| SMILES | NC1=NC2(CCCCC2)N(c2cc(S(=O)(=O)O)cc(-c3ccccc3)c2O)C(N)=N1 |
| InChI | InChI=1S/C20H23N5O4S/c21-18-23-19(22)25(20(24-18)9-5-2-6-10-20)16-12-14(30(27,28)29)11-15(17(16)26)13-7-3-1-4-8-13/h1,3-4,7-8,11-12,26H,2,5-6,9-10H2,(H,27,28,29)(H4,21,22,23,24) |
| InChIKey | KBMMYTFHIGZPLX-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 154.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.50 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|