C17H24N6O4S — CID 169375836
7-(2,4-diamino-1,3,5-triazaspiro[5.5]undeca-1,3-dien-5-yl)-N-methyl-2,3-dihydro-1,4-benzodioxine-6-sulfonamide (PubChem CID 169375836) has the molecular formula C17H24N6O4S and a molecular weight of 408.48 g/mol. Its IUPAC name is 7-(2,4-diamino-1,3,5-triazaspiro[5.5]undeca-1,3-dien-5-yl)-N-methyl-2,3-dihydro-1,4-benzodioxine-6-sulfonamide.
| Compound Name | 7-(2,4-diamino-1,3,5-triazaspiro[5.5]undeca-1,3-dien-5-yl)-N-methyl-2,3-dihydro-1,4-benzodioxine-6-sulfonamide |
|---|---|
| PubChem CID | 169375836 |
| Molecular Formula | C17H24N6O4S |
| Molecular Weight | 408.48 g/mol |
| Exact Mass | 408.16 |
| IUPAC Name | 7-(2,4-diamino-1,3,5-triazaspiro[5.5]undeca-1,3-dien-5-yl)-N-methyl-2,3-dihydro-1,4-benzodioxine-6-sulfonamide |
| SMILES | CNS(=O)(=O)c1cc2c(cc1N1C(N)=NC(N)=NC13CCCCC3)OCCO2 |
| InChI | InChI=1S/C17H24N6O4S/c1-20-28(24,25)14-10-13-12(26-7-8-27-13)9-11(14)23-16(19)21-15(18)22-17(23)5-3-2-4-6-17/h9-10,20H,2-8H2,1H3,(H4,18,19,21,22) |
| InChIKey | MKUWLTSXTIIGGT-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 144.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.48 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |