C19H25N5O2 — CID 169375778
6-(2,4-diamino-1,3,5-triazaspiro[5.5]undeca-1,3-dien-5-yl)-2,2-dimethyl-3H-chromen-4-one (PubChem CID 169375778) has the molecular formula C19H25N5O2 and a molecular weight of 355.44 g/mol. Its IUPAC name is 6-(2,4-diamino-1,3,5-triazaspiro[5.5]undeca-1,3-dien-5-yl)-2,2-dimethyl-3H-chromen-4-one.
| Compound Name | 6-(2,4-diamino-1,3,5-triazaspiro[5.5]undeca-1,3-dien-5-yl)-2,2-dimethyl-3H-chromen-4-one |
|---|---|
| PubChem CID | 169375778 |
| Molecular Formula | C19H25N5O2 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.20 |
| IUPAC Name | 6-(2,4-diamino-1,3,5-triazaspiro[5.5]undeca-1,3-dien-5-yl)-2,2-dimethyl-3H-chromen-4-one |
| SMILES | CC1(C)CC(=O)c2cc(N3C(N)=NC(N)=NC34CCCCC4)ccc2O1 |
| InChI | InChI=1S/C19H25N5O2/c1-18(2)11-14(25)13-10-12(6-7-15(13)26-18)24-17(21)22-16(20)23-19(24)8-4-3-5-9-19/h6-7,10H,3-5,8-9,11H2,1-2H3,(H4,20,21,22,23) |
| InChIKey | YKLUCGWATYIPRF-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 106.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |