C26H24N6O2 — CID 169377026
5-(2,4-diamino-1,3,5-triazaspiro[5.5]undeca-1,3-dien-5-yl)-2-naphthalen-2-ylisoindole-1,3-dione (PubChem CID 169377026) has the molecular formula C26H24N6O2 and a molecular weight of 452.52 g/mol. Its IUPAC name is 5-(2,4-diamino-1,3,5-triazaspiro[5.5]undeca-1,3-dien-5-yl)-2-naphthalen-2-ylisoindole-1,3-dione.
| Compound Name | 5-(2,4-diamino-1,3,5-triazaspiro[5.5]undeca-1,3-dien-5-yl)-2-naphthalen-2-ylisoindole-1,3-dione |
|---|---|
| PubChem CID | 169377026 |
| Molecular Formula | C26H24N6O2 |
| Molecular Weight | 452.52 g/mol |
| Exact Mass | 452.20 |
| IUPAC Name | 5-(2,4-diamino-1,3,5-triazaspiro[5.5]undeca-1,3-dien-5-yl)-2-naphthalen-2-ylisoindole-1,3-dione |
| SMILES | NC1=NC2(CCCCC2)N(c2ccc3c(c2)C(=O)N(c2ccc4ccccc4c2)C3=O)C(N)=N1 |
| InChI | InChI=1S/C26H24N6O2/c27-24-29-25(28)32(26(30-24)12-4-1-5-13-26)19-10-11-20-21(15-19)23(34)31(22(20)33)18-9-8-16-6-2-3-7-17(16)14-18/h2-3,6-11,14-15H,1,4-5,12-13H2,(H4,27,28,29,30) |
| InChIKey | WJPZFWPRYLZGBT-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 117.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.52 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|