C25H24N8O2 — CID 169373991
7-(2,4-diamino-1,3,5-triazaspiro[5.5]undeca-1,3-dien-5-yl)-3-(4-phenyltriazol-1-yl)chromen-2-one (PubChem CID 169373991) has the molecular formula C25H24N8O2 and a molecular weight of 468.52 g/mol. Its IUPAC name is 7-(2,4-diamino-1,3,5-triazaspiro[5.5]undeca-1,3-dien-5-yl)-3-(4-phenyltriazol-1-yl)chromen-2-one.
| Compound Name | 7-(2,4-diamino-1,3,5-triazaspiro[5.5]undeca-1,3-dien-5-yl)-3-(4-phenyltriazol-1-yl)chromen-2-one |
|---|---|
| PubChem CID | 169373991 |
| Molecular Formula | C25H24N8O2 |
| Molecular Weight | 468.52 g/mol |
| Exact Mass | 468.20 |
| IUPAC Name | 7-(2,4-diamino-1,3,5-triazaspiro[5.5]undeca-1,3-dien-5-yl)-3-(4-phenyltriazol-1-yl)chromen-2-one |
| SMILES | NC1=NC2(CCCCC2)N(c2ccc3cc(-n4cc(-c5ccccc5)nn4)c(=O)oc3c2)C(N)=N1 |
| InChI | InChI=1S/C25H24N8O2/c26-23-28-24(27)33(25(29-23)11-5-2-6-12-25)18-10-9-17-13-20(22(34)35-21(17)14-18)32-15-19(30-31-32)16-7-3-1-4-8-16/h1,3-4,7-10,13-15H,2,5-6,11-12H2,(H4,26,27,28,29) |
| InChIKey | CYLOFJNLVCYYNJ-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 140.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.52 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|