C33H33N5 — CID 169378313
5-(4-tritylphenyl)-1,3,5-triazaspiro[5.5]undeca-1,3-diene-2,4-diamine (PubChem CID 169378313) has the molecular formula C33H33N5 and a molecular weight of 499.66 g/mol. Its IUPAC name is 5-(4-tritylphenyl)-1,3,5-triazaspiro[5.5]undeca-1,3-diene-2,4-diamine.
| Compound Name | 5-(4-tritylphenyl)-1,3,5-triazaspiro[5.5]undeca-1,3-diene-2,4-diamine |
|---|---|
| PubChem CID | 169378313 |
| Molecular Formula | C33H33N5 |
| Molecular Weight | 499.66 g/mol |
| Exact Mass | 499.27 |
| IUPAC Name | 5-(4-tritylphenyl)-1,3,5-triazaspiro[5.5]undeca-1,3-diene-2,4-diamine |
| SMILES | NC1=NC2(CCCCC2)N(c2ccc(C(c3ccccc3)(c3ccccc3)c3ccccc3)cc2)C(N)=N1 |
| InChI | InChI=1S/C33H33N5/c34-30-36-31(35)38(32(37-30)23-11-4-12-24-32)29-21-19-28(20-22-29)33(25-13-5-1-6-14-25,26-15-7-2-8-16-26)27-17-9-3-10-18-27/h1-3,5-10,13-22H,4,11-12,23-24H2,(H4,34,35,36,37) |
| InChIKey | ZQISKLRMNRGXHC-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 80.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.66 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|