C26H26N6 — CID 169374839
5-(4-carbazol-9-ylphenyl)-1,3,5-triazaspiro[5.5]undeca-1,3-diene-2,4-diamine (PubChem CID 169374839) has the molecular formula C26H26N6 and a molecular weight of 422.54 g/mol. Its IUPAC name is 5-(4-carbazol-9-ylphenyl)-1,3,5-triazaspiro[5.5]undeca-1,3-diene-2,4-diamine.
| Compound Name | 5-(4-carbazol-9-ylphenyl)-1,3,5-triazaspiro[5.5]undeca-1,3-diene-2,4-diamine |
|---|---|
| PubChem CID | 169374839 |
| Molecular Formula | C26H26N6 |
| Molecular Weight | 422.54 g/mol |
| Exact Mass | 422.22 |
| IUPAC Name | 5-(4-carbazol-9-ylphenyl)-1,3,5-triazaspiro[5.5]undeca-1,3-diene-2,4-diamine |
| SMILES | NC1=NC2(CCCCC2)N(c2ccc(-n3c4ccccc4c4ccccc43)cc2)C(N)=N1 |
| InChI | InChI=1S/C26H26N6/c27-24-29-25(28)32(26(30-24)16-6-1-7-17-26)19-14-12-18(13-15-19)31-22-10-4-2-8-20(22)21-9-3-5-11-23(21)31/h2-5,8-15H,1,6-7,16-17H2,(H4,27,28,29,30) |
| InChIKey | SSDQYGMIRUPHHL-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 84.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.54 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |